C16H24N2O2S — CID 64550265
N-(2,5-diethoxyphenyl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine (PubChem CID 64550265) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(2,5-diethoxyphenyl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 64550265 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(OCC)c(NC2=NC(C)(CC)CS2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c1-5-16(4)11-21-15(18-16)17-13-10-12(19-6-2)8-9-14(13)20-7-3/h8-10H,5-7,11H2,1-4H3,(H,17,18) |
| InChIKey | ZOQDXDABJVOQET-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |