C13H15N3O3S — CID 3435999
1-[[4-(2,4-dimethoxyanilino)-1,3-thiazet-2-ylidene]amino]propan-2-one (PubChem CID 3435999) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-[[4-(2,4-dimethoxyanilino)-1,3-thiazet-2-ylidene]amino]propan-2-one.
| Compound Name | 1-[[4-(2,4-dimethoxyanilino)-1,3-thiazet-2-ylidene]amino]propan-2-one |
|---|---|
| PubChem CID | 3435999 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-[[4-(2,4-dimethoxyanilino)-1,3-thiazet-2-ylidene]amino]propan-2-one |
| SMILES | COc1ccc(NC2=N/C(=N/CC(C)=O)S2)c(OC)c1 |
| InChI | InChI=1S/C13H15N3O3S/c1-8(17)7-14-12-16-13(20-12)15-10-5-4-9(18-2)6-11(10)19-3/h4-6H,7H2,1-3H3,(H,14,15,16) |
| InChIKey | OCBUORGZYAVYKQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|