C14H15FINS — CID 114260892
1-[5-(3-fluoro-2-iodophenyl)thiophen-2-yl]-N-methylpropan-1-amine (PubChem CID 114260892) has the molecular formula C14H15FINS and a molecular weight of 375.25 g/mol. Its IUPAC name is 1-[5-(3-fluoro-2-iodophenyl)thiophen-2-yl]-N-methylpropan-1-amine.
| Compound Name | 1-[5-(3-fluoro-2-iodophenyl)thiophen-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 114260892 |
| Molecular Formula | C14H15FINS |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 1-[5-(3-fluoro-2-iodophenyl)thiophen-2-yl]-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccc(-c2cccc(F)c2I)s1 |
| InChI | InChI=1S/C14H15FINS/c1-3-11(17-2)13-8-7-12(18-13)9-5-4-6-10(15)14(9)16/h4-8,11,17H,3H2,1-2H3 |
| InChIKey | LCSSVBPVZCXDPY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|