C13H13BrIN3 — CID 114261495
N-[[1-(2-bromo-5-iodophenyl)imidazol-4-yl]methyl]cyclopropanamine (PubChem CID 114261495) has the molecular formula C13H13BrIN3 and a molecular weight of 418.08 g/mol. Its IUPAC name is N-[[1-(2-bromo-5-iodophenyl)imidazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(2-bromo-5-iodophenyl)imidazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114261495 |
| Molecular Formula | C13H13BrIN3 |
| Molecular Weight | 418.08 g/mol |
| Exact Mass | 416.93 |
| IUPAC Name | N-[[1-(2-bromo-5-iodophenyl)imidazol-4-yl]methyl]cyclopropanamine |
| SMILES | Brc1ccc(I)cc1-n1cnc(CNC2CC2)c1 |
| InChI | InChI=1S/C13H13BrIN3/c14-12-4-1-9(15)5-13(12)18-7-11(17-8-18)6-16-10-2-3-10/h1,4-5,7-8,10,16H,2-3,6H2 |
| InChIKey | YQPUJLYSPMDXKO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.08 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|