C12H12BrClN4 — CID 81271668
N-[[1-(2-bromo-4-chlorophenyl)triazol-4-yl]methyl]cyclopropanamine (PubChem CID 81271668) has the molecular formula C12H12BrClN4 and a molecular weight of 327.61 g/mol. Its IUPAC name is N-[[1-(2-bromo-4-chlorophenyl)triazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-(2-bromo-4-chlorophenyl)triazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81271668 |
| Molecular Formula | C12H12BrClN4 |
| Molecular Weight | 327.61 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | N-[[1-(2-bromo-4-chlorophenyl)triazol-4-yl]methyl]cyclopropanamine |
| SMILES | Clc1ccc(-n2cc(CNC3CC3)nn2)c(Br)c1 |
| InChI | InChI=1S/C12H12BrClN4/c13-11-5-8(14)1-4-12(11)18-7-10(16-17-18)6-15-9-2-3-9/h1,4-5,7,9,15H,2-3,6H2 |
| InChIKey | ZAWRGBYQTXMEOX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |