C14H27O4P — CID 11426297
1-cyclohexyl-1-diethoxyphosphorylbut-3-en-1-ol (PubChem CID 11426297) has the molecular formula C14H27O4P and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-cyclohexyl-1-diethoxyphosphorylbut-3-en-1-ol.
| Compound Name | 1-cyclohexyl-1-diethoxyphosphorylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11426297 |
| Molecular Formula | C14H27O4P |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-cyclohexyl-1-diethoxyphosphorylbut-3-en-1-ol |
| SMILES | C=CCC(O)(C1CCCCC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H27O4P/c1-4-12-14(15,13-10-8-7-9-11-13)19(16,17-5-2)18-6-3/h4,13,15H,1,5-12H2,2-3H3 |
| InChIKey | XLWICDMRGQYMPT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|