C20H22N2 — CID 11426309
2-[cyclohexyl(phenyl)methyl]-1H-benzimidazole (PubChem CID 11426309) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[cyclohexyl(phenyl)methyl]-1H-benzimidazole.
| Compound Name | 2-[cyclohexyl(phenyl)methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11426309 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[cyclohexyl(phenyl)methyl]-1H-benzimidazole |
| SMILES | c1ccc(C(c2nc3ccccc3[nH]2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22N2/c1-3-9-15(10-4-1)19(16-11-5-2-6-12-16)20-21-17-13-7-8-14-18(17)22-20/h1,3-4,7-10,13-14,16,19H,2,5-6,11-12H2,(H,21,22) |
| InChIKey | QIUUASDUULWILV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |