C14H25NO4 — CID 114264028
tert-butyl 4-oxo-4-(2-prop-2-enoxypropylamino)butanoate (PubChem CID 114264028) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl 4-oxo-4-(2-prop-2-enoxypropylamino)butanoate.
| Compound Name | tert-butyl 4-oxo-4-(2-prop-2-enoxypropylamino)butanoate |
|---|---|
| PubChem CID | 114264028 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl 4-oxo-4-(2-prop-2-enoxypropylamino)butanoate |
| SMILES | C=CCOC(C)CNC(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-6-9-18-11(2)10-15-12(16)7-8-13(17)19-14(3,4)5/h6,11H,1,7-10H2,2-5H3,(H,15,16) |
| InChIKey | NQMOXWJOTHQVKT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|