C13H17ClFNO — CID 114264054
N-[(4-chloro-2-fluorophenyl)methyl]-2-prop-2-enoxypropan-1-amine (PubChem CID 114264054) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is N-[(4-chloro-2-fluorophenyl)methyl]-2-prop-2-enoxypropan-1-amine.
| Compound Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-prop-2-enoxypropan-1-amine |
|---|---|
| PubChem CID | 114264054 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[(4-chloro-2-fluorophenyl)methyl]-2-prop-2-enoxypropan-1-amine |
| SMILES | C=CCOC(C)CNCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFNO/c1-3-6-17-10(2)8-16-9-11-4-5-12(14)7-13(11)15/h3-5,7,10,16H,1,6,8-9H2,2H3 |
| InChIKey | ZPOHZDIDYRTXKT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|