C15H20N2O — CID 114265543
N-(3,3-dimethylcyclohexyl)-1,2-benzoxazol-3-amine (PubChem CID 114265543) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(3,3-dimethylcyclohexyl)-1,2-benzoxazol-3-amine.
| Compound Name | N-(3,3-dimethylcyclohexyl)-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 114265543 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(3,3-dimethylcyclohexyl)-1,2-benzoxazol-3-amine |
| SMILES | CC1(C)CCCC(Nc2noc3ccccc23)C1 |
| InChI | InChI=1S/C15H20N2O/c1-15(2)9-5-6-11(10-15)16-14-12-7-3-4-8-13(12)18-17-14/h3-4,7-8,11H,5-6,9-10H2,1-2H3,(H,16,17) |
| InChIKey | RGPJFMDDMUNEFY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |