C13H17ClINO — CID 114266795
2-chloro-4-iodo-N-[1-(oxolan-3-yl)propyl]aniline (PubChem CID 114266795) has the molecular formula C13H17ClINO and a molecular weight of 365.64 g/mol. Its IUPAC name is 2-chloro-4-iodo-N-[1-(oxolan-3-yl)propyl]aniline.
| Compound Name | 2-chloro-4-iodo-N-[1-(oxolan-3-yl)propyl]aniline |
|---|---|
| PubChem CID | 114266795 |
| Molecular Formula | C13H17ClINO |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-chloro-4-iodo-N-[1-(oxolan-3-yl)propyl]aniline |
| SMILES | CCC(Nc1ccc(I)cc1Cl)C1CCOC1 |
| InChI | InChI=1S/C13H17ClINO/c1-2-12(9-5-6-17-8-9)16-13-4-3-10(15)7-11(13)14/h3-4,7,9,12,16H,2,5-6,8H2,1H3 |
| InChIKey | SUOMJGZRENCOEB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|