C19H28N4O2 — CID 114267998
tert-butyl N-methyl-N-[1-[(5-phenyl-1H-pyrazol-4-yl)methylamino]propan-2-yl]carbamate (PubChem CID 114267998) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[(5-phenyl-1H-pyrazol-4-yl)methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[(5-phenyl-1H-pyrazol-4-yl)methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 114267998 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[(5-phenyl-1H-pyrazol-4-yl)methylamino]propan-2-yl]carbamate |
| SMILES | CC(CNCc1cn[nH]c1-c1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N4O2/c1-14(23(5)18(24)25-19(2,3)4)11-20-12-16-13-21-22-17(16)15-9-7-6-8-10-15/h6-10,13-14,20H,11-12H2,1-5H3,(H,21,22) |
| InChIKey | PHSRKQFOZBVVMS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |