C15H23NOS — CID 114269774
2-(ethoxymethyl)-N-[(1-methylsulfanylcyclobutyl)methyl]aniline (PubChem CID 114269774) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-(ethoxymethyl)-N-[(1-methylsulfanylcyclobutyl)methyl]aniline.
| Compound Name | 2-(ethoxymethyl)-N-[(1-methylsulfanylcyclobutyl)methyl]aniline |
|---|---|
| PubChem CID | 114269774 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(ethoxymethyl)-N-[(1-methylsulfanylcyclobutyl)methyl]aniline |
| SMILES | CCOCc1ccccc1NCC1(SC)CCC1 |
| InChI | InChI=1S/C15H23NOS/c1-3-17-11-13-7-4-5-8-14(13)16-12-15(18-2)9-6-10-15/h4-5,7-8,16H,3,6,9-12H2,1-2H3 |
| InChIKey | PNPHFQMQSGQBNA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |