C10H12F3N3O — CID 114270139
N-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanamide (PubChem CID 114270139) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is N-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanamide.
| Compound Name | N-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanamide |
|---|---|
| PubChem CID | 114270139 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-methyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanamide |
| SMILES | CNC(=O)C(C)Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N3O/c1-6(9(17)14-2)16-7-3-4-15-8(5-7)10(11,12)13/h3-6H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | MMLLXPAAUAZYHP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |