C12H13F3N2O2 — CID 112735039
3-cyclopropyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanoic acid (PubChem CID 112735039) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanoic acid.
| Compound Name | 3-cyclopropyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 112735039 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-cyclopropyl-2-[[2-(trifluoromethyl)-4-pyridinyl]amino]propanoic acid |
| SMILES | O=C(O)C(CC1CC1)Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)10-6-8(3-4-16-10)17-9(11(18)19)5-7-1-2-7/h3-4,6-7,9H,1-2,5H2,(H,16,17)(H,18,19) |
| InChIKey | NISZPGCZKCFAHM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |