C14H9F6N3O4S2 — CID 171096108
[4-cyclopropyl-3-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]-1,2-thiazol-5-yl] trifluoromethanesulfonate (PubChem CID 171096108) has the molecular formula C14H9F6N3O4S2 and a molecular weight of 461.37 g/mol. Its IUPAC name is [4-cyclopropyl-3-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]-1,2-thiazol-5-yl] trifluoromethanesulfonate.
| Compound Name | [4-cyclopropyl-3-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]-1,2-thiazol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171096108 |
| Molecular Formula | C14H9F6N3O4S2 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | [4-cyclopropyl-3-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]-1,2-thiazol-5-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1ccnc(C(F)(F)F)c1)c1nsc(OS(=O)(=O)C(F)(F)F)c1C1CC1 |
| InChI | InChI=1S/C14H9F6N3O4S2/c15-13(16,17)8-5-7(3-4-21-8)22-11(24)10-9(6-1-2-6)12(28-23-10)27-29(25,26)14(18,19)20/h3-6H,1-2H2,(H,21,22,24) |
| InChIKey | NKWUNMDUARFFJG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|