C14H7F8N3O2 — CID 130387825
2-[(2,3,4,5,6-pentafluorophenoxy)amino]-N-[2-(trifluoromethyl)-4-pyridinyl]acetamide (PubChem CID 130387825) has the molecular formula C14H7F8N3O2 and a molecular weight of 401.21 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenoxy)amino]-N-[2-(trifluoromethyl)-4-pyridinyl]acetamide.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenoxy)amino]-N-[2-(trifluoromethyl)-4-pyridinyl]acetamide |
|---|---|
| PubChem CID | 130387825 |
| Molecular Formula | C14H7F8N3O2 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenoxy)amino]-N-[2-(trifluoromethyl)-4-pyridinyl]acetamide |
| SMILES | O=C(CNOc1c(F)c(F)c(F)c(F)c1F)Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H7F8N3O2/c15-8-9(16)11(18)13(12(19)10(8)17)27-24-4-7(26)25-5-1-2-23-6(3-5)14(20,21)22/h1-3,24H,4H2,(H,23,25,26) |
| InChIKey | KPAGPACBESZMCI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|