C18H13F3N2O2S — CID 170235546
S-(naphthalen-1-yloxymethyl) N-[2-(trifluoromethyl)-4-pyridinyl]carbamothioate (PubChem CID 170235546) has the molecular formula C18H13F3N2O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is S-(naphthalen-1-yloxymethyl) N-[2-(trifluoromethyl)-4-pyridinyl]carbamothioate.
| Compound Name | S-(naphthalen-1-yloxymethyl) N-[2-(trifluoromethyl)-4-pyridinyl]carbamothioate |
|---|---|
| PubChem CID | 170235546 |
| Molecular Formula | C18H13F3N2O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | S-(naphthalen-1-yloxymethyl) N-[2-(trifluoromethyl)-4-pyridinyl]carbamothioate |
| SMILES | O=C(Nc1ccnc(C(F)(F)F)c1)SCOc1cccc2ccccc12 |
| InChI | InChI=1S/C18H13F3N2O2S/c19-18(20,21)16-10-13(8-9-22-16)23-17(24)26-11-25-15-7-3-5-12-4-1-2-6-14(12)15/h1-10H,11H2,(H,22,23,24) |
| InChIKey | ZWTRRGIBRHKOAH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|