C18H19F3N2O3 — CID 118730959
6-(3-hydroxyphenoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]hexanamide (PubChem CID 118730959) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 6-(3-hydroxyphenoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]hexanamide.
| Compound Name | 6-(3-hydroxyphenoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]hexanamide |
|---|---|
| PubChem CID | 118730959 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-(3-hydroxyphenoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]hexanamide |
| SMILES | O=C(CCCCCOc1cccc(O)c1)Nc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O3/c19-18(20,21)16-11-13(8-9-22-16)23-17(25)7-2-1-3-10-26-15-6-4-5-14(24)12-15/h4-6,8-9,11-12,24H,1-3,7,10H2,(H,22,23,25) |
| InChIKey | MBKRQUAZSTZGFG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|