C17H18BrFN2O2 — CID 118730983
6-(3-bromophenoxy)-N-(2-fluoro-4-pyridinyl)hexanamide (PubChem CID 118730983) has the molecular formula C17H18BrFN2O2 and a molecular weight of 381.25 g/mol. Its IUPAC name is 6-(3-bromophenoxy)-N-(2-fluoro-4-pyridinyl)hexanamide.
| Compound Name | 6-(3-bromophenoxy)-N-(2-fluoro-4-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 118730983 |
| Molecular Formula | C17H18BrFN2O2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 6-(3-bromophenoxy)-N-(2-fluoro-4-pyridinyl)hexanamide |
| SMILES | O=C(CCCCCOc1cccc(Br)c1)Nc1ccnc(F)c1 |
| InChI | InChI=1S/C17H18BrFN2O2/c18-13-5-4-6-15(11-13)23-10-3-1-2-7-17(22)21-14-8-9-20-16(19)12-14/h4-6,8-9,11-12H,1-3,7,10H2,(H,20,21,22) |
| InChIKey | SKRSIUVCTORQPX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|