C12H21F2N3O — CID 114270881
N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1-pyrazol-1-ylbutan-2-amine (PubChem CID 114270881) has the molecular formula C12H21F2N3O and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1-pyrazol-1-ylbutan-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1-pyrazol-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 114270881 |
| Molecular Formula | C12H21F2N3O |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-methyl-1-pyrazol-1-ylbutan-2-amine |
| SMILES | CC(C)C(Cn1cccn1)NCCOCC(F)F |
| InChI | InChI=1S/C12H21F2N3O/c1-10(2)11(8-17-6-3-4-16-17)15-5-7-18-9-12(13)14/h3-4,6,10-12,15H,5,7-9H2,1-2H3 |
| InChIKey | WXHJEKYWRVIRKR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|