C8H14FN3O — CID 135133191
(2R,3S)-4-fluoro-3-methoxy-1-pyrazol-1-ylbutan-2-amine (PubChem CID 135133191) has the molecular formula C8H14FN3O and a molecular weight of 187.22 g/mol. Its IUPAC name is (2R,3S)-4-fluoro-3-methoxy-1-pyrazol-1-ylbutan-2-amine.
| Compound Name | (2R,3S)-4-fluoro-3-methoxy-1-pyrazol-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 135133191 |
| Molecular Formula | C8H14FN3O |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2R,3S)-4-fluoro-3-methoxy-1-pyrazol-1-ylbutan-2-amine |
| SMILES | CO[C@H](CF)[C@H](N)Cn1cccn1 |
| InChI | InChI=1S/C8H14FN3O/c1-13-8(5-9)7(10)6-12-4-2-3-11-12/h2-4,7-8H,5-6,10H2,1H3/t7-,8-/m1/s1 |
| InChIKey | GKWVUUZJAGFSHW-HTQZYQBOSA-N |
| XLogP | 0.19 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |