C9H15F3N2O2S2 — CID 114271843
2-[3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylbutanethioamide (PubChem CID 114271843) has the molecular formula C9H15F3N2O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylbutanethioamide.
| Compound Name | 2-[3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylbutanethioamide |
|---|---|
| PubChem CID | 114271843 |
| Molecular Formula | C9H15F3N2O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[3-(trifluoromethyl)pyrrolidin-1-yl]sulfonylbutanethioamide |
| SMILES | CCC(C(N)=S)S(=O)(=O)N1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O2S2/c1-2-7(8(13)17)18(15,16)14-4-3-6(5-14)9(10,11)12/h6-7H,2-5H2,1H3,(H2,13,17) |
| InChIKey | GELCPCGXPPZFTQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|