C14H16BrNO — CID 114273362
1-[2-(4-bromophenoxy)ethyl]-3,4-dimethylpyrrole (PubChem CID 114273362) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethyl]-3,4-dimethylpyrrole.
| Compound Name | 1-[2-(4-bromophenoxy)ethyl]-3,4-dimethylpyrrole |
|---|---|
| PubChem CID | 114273362 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethyl]-3,4-dimethylpyrrole |
| SMILES | Cc1cn(CCOc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C14H16BrNO/c1-11-9-16(10-12(11)2)7-8-17-14-5-3-13(15)4-6-14/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | PCNGEOUDJRTEHU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |