C14H17BrN2O — CID 66406852
2-[1-[2-(4-bromophenoxy)ethyl]pyrrol-3-yl]ethanamine (PubChem CID 66406852) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-[1-[2-(4-bromophenoxy)ethyl]pyrrol-3-yl]ethanamine.
| Compound Name | 2-[1-[2-(4-bromophenoxy)ethyl]pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 66406852 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[1-[2-(4-bromophenoxy)ethyl]pyrrol-3-yl]ethanamine |
| SMILES | NCCc1ccn(CCOc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C14H17BrN2O/c15-13-1-3-14(4-2-13)18-10-9-17-8-6-12(11-17)5-7-16/h1-4,6,8,11H,5,7,9-10,16H2 |
| InChIKey | SYWFRVBXJFQVPP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |