C22H32O2 — CID 11427440
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one (PubChem CID 11427440) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one |
|---|---|
| PubChem CID | 11427440 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dimethyl-7,8-dihydro-6H-chromen-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1(C)C=CC2=C(CC(C)CC2=O)O1 |
| InChI | InChI=1S/C22H32O2/c1-16(2)8-6-9-17(3)10-7-12-22(5)13-11-19-20(23)14-18(4)15-21(19)24-22/h8,10-11,13,18H,6-7,9,12,14-15H2,1-5H3/b17-10+ |
| InChIKey | JRRNMYLIODRJDC-LICLKQGHSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|