C29H48O2 — CID 75033058
2,5,8-trimethyl-7-methylidene-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-one (PubChem CID 75033058) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2,5,8-trimethyl-7-methylidene-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-one.
| Compound Name | 2,5,8-trimethyl-7-methylidene-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-one |
|---|---|
| PubChem CID | 75033058 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 2,5,8-trimethyl-7-methylidene-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-one |
| SMILES | C=C1C(=O)C(C)=C2CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)OC2=C1C |
| InChI | InChI=1S/C29H48O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22H,5,9-19H2,1-4,6-8H3 |
| InChIKey | QKZGLLMOIBGPPQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|