C14H20O2 — CID 151696943
2,2,5,7,8-pentamethyl-4,5-dihydro-3H-chromen-6-one (PubChem CID 151696943) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,2,5,7,8-pentamethyl-4,5-dihydro-3H-chromen-6-one.
| Compound Name | 2,2,5,7,8-pentamethyl-4,5-dihydro-3H-chromen-6-one |
|---|---|
| PubChem CID | 151696943 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,2,5,7,8-pentamethyl-4,5-dihydro-3H-chromen-6-one |
| SMILES | CC1=C(C)C2=C(CCC(C)(C)O2)C(C)C1=O |
| InChI | InChI=1S/C14H20O2/c1-8-9(2)13-11(10(3)12(8)15)6-7-14(4,5)16-13/h10H,6-7H2,1-5H3 |
| InChIKey | RDTOIJIJGULQHG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |