C29H43O2 — CID 131769849
alpha-Tocotrienoxyl radical (PubChem CID 131769849) has the molecular formula C29H43O2 and a molecular weight of 423.66 g/mol.
| Compound Name | alpha-Tocotrienoxyl radical |
|---|---|
| PubChem CID | 131769849 |
| Molecular Formula | C29H43O2 |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCC2=C(C)C(=O)C(C)=C(C)[C]2O1 |
| InChI | InChI=1S/C29H43O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h12,14,16H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16+ |
| InChIKey | LALWPXWRMGORIU-KTWAZNHYSA-N |
| XLogP | 8.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|