C31H49O- — CID 59271505
8a-butyl-2-[(4E,8E)-4,8-dimethyltrideca-4,8-dienyl]-2,7,8-trimethyl-3,4-dihydrochromene (PubChem CID 59271505) has the molecular formula C31H49O- and a molecular weight of 437.73 g/mol. Its IUPAC name is 8a-butyl-2-[(4E,8E)-4,8-dimethyltrideca-4,8-dienyl]-2,7,8-trimethyl-3,4-dihydrochromene.
| Compound Name | 8a-butyl-2-[(4E,8E)-4,8-dimethyltrideca-4,8-dienyl]-2,7,8-trimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 59271505 |
| Molecular Formula | C31H49O- |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 437.38 |
| IUPAC Name | 8a-butyl-2-[(4E,8E)-4,8-dimethyltrideca-4,8-dienyl]-2,7,8-trimethyl-3,4-dihydrochromene |
| SMILES | C[CH-]CC/C=C(\C)CC/C=C(\C)CCCC1(C)CCC2=C=CC(C)=C(C)C2(CCCC)O1 |
| InChI | InChI=1S/C31H49O/c1-8-10-12-15-25(3)16-13-17-26(4)18-14-22-30(7)24-21-29-20-19-27(5)28(6)31(29,32-30)23-11-9-2/h8,15,17,19H,9-14,16,18,21-24H2,1-7H3/q-1/b25-15+,26-17+ |
| InChIKey | AMOWNUOXDSUHBT-VUFZMPSASA-N |
| XLogP | 9.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|