C18H25N3O3 — CID 114274709
benzyl (3S)-3-amino-4-[2-cyanoethyl(2-methylpropyl)amino]-4-oxobutanoate (PubChem CID 114274709) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-[2-cyanoethyl(2-methylpropyl)amino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-[2-cyanoethyl(2-methylpropyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 114274709 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | benzyl (3S)-3-amino-4-[2-cyanoethyl(2-methylpropyl)amino]-4-oxobutanoate |
| SMILES | CC(C)CN(CCC#N)C(=O)[C@@H](N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25N3O3/c1-14(2)12-21(10-6-9-19)18(23)16(20)11-17(22)24-13-15-7-4-3-5-8-15/h3-5,7-8,14,16H,6,10-13,20H2,1-2H3/t16-/m0/s1 |
| InChIKey | LQRQHAFHKBNGFJ-INIZCTEOSA-N |
| XLogP | 1.85 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |