C18H19FN2O4 — CID 114274759
benzyl (3S)-3-amino-4-(4-fluoro-2-methoxyanilino)-4-oxobutanoate (PubChem CID 114274759) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-(4-fluoro-2-methoxyanilino)-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-(4-fluoro-2-methoxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 114274759 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | benzyl (3S)-3-amino-4-(4-fluoro-2-methoxyanilino)-4-oxobutanoate |
| SMILES | COc1cc(F)ccc1NC(=O)[C@@H](N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19FN2O4/c1-24-16-9-13(19)7-8-15(16)21-18(23)14(20)10-17(22)25-11-12-5-3-2-4-6-12/h2-9,14H,10-11,20H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | ZNJKBNQKQRLITD-AWEZNQCLSA-N |
| XLogP | 2.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |