C17H23N3O4 — CID 114274809
benzyl (3S)-3-amino-4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoate (PubChem CID 114274809) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 114274809 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | benzyl (3S)-3-amino-4-(2,2-dimethyl-3-oxopiperazin-1-yl)-4-oxobutanoate |
| SMILES | CC1(C)C(=O)NCCN1C(=O)[C@@H](N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O4/c1-17(2)16(23)19-8-9-20(17)15(22)13(18)10-14(21)24-11-12-6-4-3-5-7-12/h3-7,13H,8-11,18H2,1-2H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | XJDGFRHKSAVADL-ZDUSSCGKSA-N |
| XLogP | 0.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |