C15H18N2O7 — CID 174974607
(2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid;3-hydroxypyrrolidine-2,5-dione (PubChem CID 174974607) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is (2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174974607 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2S)-2-amino-4-oxo-4-phenylmethoxybutanoic acid;3-hydroxypyrrolidine-2,5-dione |
| SMILES | N[C@@H](CC(=O)OCc1ccccc1)C(=O)O.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C11H13NO4.C4H5NO3/c12-9(11(14)15)6-10(13)16-7-8-4-2-1-3-5-8;6-2-1-3(7)5-4(2)8/h1-5,9H,6-7,12H2,(H,14,15);2,6H,1H2,(H,5,7,8)/t9-;/m0./s1 |
| InChIKey | YWMYYCILNREUJY-FVGYRXGTSA-N |
| XLogP | -1.07 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|