C18H22NO3P — CID 11427522
(2S,5S)-4-benzyl-2-ethoxy-5-phenyl-1,4,2λ5-oxazaphosphinane 2-oxide (PubChem CID 11427522) has the molecular formula C18H22NO3P and a molecular weight of 331.35 g/mol. Its IUPAC name is (2S,5S)-4-benzyl-2-ethoxy-5-phenyl-1,4,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (2S,5S)-4-benzyl-2-ethoxy-5-phenyl-1,4,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 11427522 |
| Molecular Formula | C18H22NO3P |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (2S,5S)-4-benzyl-2-ethoxy-5-phenyl-1,4,2λ5-oxazaphosphinane 2-oxide |
| SMILES | CCO[P@@]1(=O)CN(Cc2ccccc2)[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C18H22NO3P/c1-2-21-23(20)15-19(13-16-9-5-3-6-10-16)18(14-22-23)17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3/t18-,23+/m1/s1 |
| InChIKey | WWGOGBGAKNKNLR-JPYJTQIMSA-N |
| XLogP | 4.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|