C14H13ClF2N2S — CID 114275473
[(6-chloro-2,3-difluorophenyl)-(4-methylsulfanylphenyl)methyl]hydrazine (PubChem CID 114275473) has the molecular formula C14H13ClF2N2S and a molecular weight of 314.79 g/mol. Its IUPAC name is [(6-chloro-2,3-difluorophenyl)-(4-methylsulfanylphenyl)methyl]hydrazine.
| Compound Name | [(6-chloro-2,3-difluorophenyl)-(4-methylsulfanylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 114275473 |
| Molecular Formula | C14H13ClF2N2S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [(6-chloro-2,3-difluorophenyl)-(4-methylsulfanylphenyl)methyl]hydrazine |
| SMILES | CSc1ccc(C(NN)c2c(Cl)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C14H13ClF2N2S/c1-20-9-4-2-8(3-5-9)14(19-18)12-10(15)6-7-11(16)13(12)17/h2-7,14,19H,18H2,1H3 |
| InChIKey | AZIBEYCNKGRZST-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|