About 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine
4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine (PubChem CID 114276784) has the molecular formula C10H9F2N3OS
and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine |
| PubChem CID | 114276784 |
| Molecular Formula | C10H9F2N3OS |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine |
| SMILES | Cc1cc(F)c(F)cc1OCc1nnsc1N |
| InChI | InChI=1S/C10H9F2N3OS/c1-5-2-6(11)7(12)3-9(5)16-4-8-10(13)17-15-14-8/h2-3H,4,13H2,1H3 |
| InChIKey | CSTAXWDAWVOHRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine?
The IUPAC name of 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine (CID 114276784) is 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine.
What is the SMILES notation for 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine?
The canonical SMILES for 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine is Cc1cc(F)c(F)cc1OCc1nnsc1N.
What is the InChIKey of 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine?
The InChIKey is CSTAXWDAWVOHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N3OS/c1-5-2-6(11)7(12)3-9(5)16-4-8-10(13)17-15-14-8/h2-3H,4,13H2,1H3.
What are the key properties of 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine?
4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine has a molecular weight of 257.26 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine is sourced from PubChem (CID 114276784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).