C10H9F2N3OS — CID 114276784
4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine (PubChem CID 114276784) has the molecular formula C10H9F2N3OS and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine.
| Compound Name | 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 114276784 |
| Molecular Formula | C10H9F2N3OS |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(4,5-difluoro-2-methylphenoxy)methyl]thiadiazol-5-amine |
| SMILES | Cc1cc(F)c(F)cc1OCc1nnsc1N |
| InChI | InChI=1S/C10H9F2N3OS/c1-5-2-6(11)7(12)3-9(5)16-4-8-10(13)17-15-14-8/h2-3H,4,13H2,1H3 |
| InChIKey | CSTAXWDAWVOHRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |