C14H28N2O2 — CID 114277119
1-amino-N-(2,2-dimethylpropyl)-N-methoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 114277119) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-amino-N-(2,2-dimethylpropyl)-N-methoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(2,2-dimethylpropyl)-N-methoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114277119 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-amino-N-(2,2-dimethylpropyl)-N-methoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | CON(CC(C)(C)C)C(=O)C1(N)CCCC(C)C1 |
| InChI | InChI=1S/C14H28N2O2/c1-11-7-6-8-14(15,9-11)12(17)16(18-5)10-13(2,3)4/h11H,6-10,15H2,1-5H3 |
| InChIKey | INTFYEUFGIOBGL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|