C18H14N2O5 — CID 11427713
2-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-2-yl)-5-nitrobenzaldehyde (PubChem CID 11427713) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-2-yl)-5-nitrobenzaldehyde.
| Compound Name | 2-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-2-yl)-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 11427713 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-2-yl)-5-nitrobenzaldehyde |
| SMILES | CCc1c(-c2ccccc2)n(-c2ccc([N+](=O)[O-])cc2C=O)oc1=O |
| InChI | InChI=1S/C18H14N2O5/c1-2-15-17(12-6-4-3-5-7-12)19(25-18(15)22)16-9-8-14(20(23)24)10-13(16)11-21/h3-11H,2H2,1H3 |
| InChIKey | GBOZVUVVAGHOMU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|