C19H14N3O4S+ — CID 100978989
2-methyl-4-[2-(6-nitro-1,3-benzothiazol-3-ium-2-yl)ethenyl]-3-phenyl-1,2-oxazol-5-one (PubChem CID 100978989) has the molecular formula C19H14N3O4S+ and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-methyl-4-[2-(6-nitro-1,3-benzothiazol-3-ium-2-yl)ethenyl]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | 2-methyl-4-[2-(6-nitro-1,3-benzothiazol-3-ium-2-yl)ethenyl]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 100978989 |
| Molecular Formula | C19H14N3O4S+ |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-methyl-4-[2-(6-nitro-1,3-benzothiazol-3-ium-2-yl)ethenyl]-3-phenyl-1,2-oxazol-5-one |
| SMILES | Cn1oc(=O)c(C=Cc2[nH+]c3ccc([N+](=O)[O-])cc3s2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H13N3O4S/c1-21-18(12-5-3-2-4-6-12)14(19(23)26-21)8-10-17-20-15-9-7-13(22(24)25)11-16(15)27-17/h2-11H,1H3/p+1 |
| InChIKey | HFIBNUAPVXVXCQ-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|