C22H32O3 — CID 11427923
11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane (PubChem CID 11427923) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane.
| Compound Name | 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane |
|---|---|
| PubChem CID | 11427923 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OOC1(CCC(c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C22H32O3/c1-20(2,3)19-11-15-22(16-12-19)23-21(24-25-22)13-9-18(10-14-21)17-7-5-4-6-8-17/h4-8,18-19H,9-16H2,1-3H3 |
| InChIKey | VACAYQVETLMVLL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|