About 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane
11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane (PubChem CID 11427923) has the molecular formula C22H32O3
and a molecular weight of 344.50 g/mol. Its IUPAC name is 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane.
Molecular Properties
| Compound Name | 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane |
| PubChem CID | 11427923 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OOC1(CCC(c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C22H32O3/c1-20(2,3)19-11-15-22(16-12-19)23-21(24-25-22)13-9-18(10-14-21)17-7-5-4-6-8-17/h4-8,18-19H,9-16H2,1-3H3 |
| InChIKey | VACAYQVETLMVLL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane?
The IUPAC name of 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane (CID 11427923) is 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane.
What is the SMILES notation for 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane?
The canonical SMILES for 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane is CC(C)(C)C1CCC2(CC1)OOC1(CCC(c3ccccc3)CC1)O2.
What is the InChIKey of 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane?
The InChIKey is VACAYQVETLMVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O3/c1-20(2,3)19-11-15-22(16-12-19)23-21(24-25-22)13-9-18(10-14-21)17-7-5-4-6-8-17/h4-8,18-19H,9-16H2,1-3H3.
What are the key properties of 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane?
11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane has a molecular weight of 344.50 g/mol, XLogP of 5.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-tert-butyl-3-phenyl-7,14,15-trioxadispiro[5.1.58.26]pentadecane is sourced from PubChem (CID 11427923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).