C16H21IO2 — CID 114279702
1-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)octan-1-one (PubChem CID 114279702) has the molecular formula C16H21IO2 and a molecular weight of 372.25 g/mol. Its IUPAC name is 1-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)octan-1-one.
| Compound Name | 1-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)octan-1-one |
|---|---|
| PubChem CID | 114279702 |
| Molecular Formula | C16H21IO2 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1cc(I)cc2c1OCC2 |
| InChI | InChI=1S/C16H21IO2/c1-2-3-4-5-6-7-15(18)14-11-13(17)10-12-8-9-19-16(12)14/h10-11H,2-9H2,1H3 |
| InChIKey | NAXODLUJLBCMRW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|