C20H31ClN2O2 — CID 114280549
tert-butyl 4-[[(3-chlorophenyl)methylamino]methyl]-4-ethylpiperidine-1-carboxylate (PubChem CID 114280549) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is tert-butyl 4-[[(3-chlorophenyl)methylamino]methyl]-4-ethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(3-chlorophenyl)methylamino]methyl]-4-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 114280549 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | tert-butyl 4-[[(3-chlorophenyl)methylamino]methyl]-4-ethylpiperidine-1-carboxylate |
| SMILES | CCC1(CNCc2cccc(Cl)c2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H31ClN2O2/c1-5-20(15-22-14-16-7-6-8-17(21)13-16)9-11-23(12-10-20)18(24)25-19(2,3)4/h6-8,13,22H,5,9-12,14-15H2,1-4H3 |
| InChIKey | JBTAINGNUZQZQJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |