C19H32N4O2 — CID 114280757
tert-butyl 3-propyl-3-[(pyrimidin-4-ylmethylamino)methyl]piperidine-1-carboxylate (PubChem CID 114280757) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl 3-propyl-3-[(pyrimidin-4-ylmethylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-propyl-3-[(pyrimidin-4-ylmethylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 114280757 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | tert-butyl 3-propyl-3-[(pyrimidin-4-ylmethylamino)methyl]piperidine-1-carboxylate |
| SMILES | CCCC1(CNCc2ccncn2)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H32N4O2/c1-5-8-19(13-21-12-16-7-10-20-15-22-16)9-6-11-23(14-19)17(24)25-18(2,3)4/h7,10,15,21H,5-6,8-9,11-14H2,1-4H3 |
| InChIKey | LMRPTEVUGVDORO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |