C16H28N2 — CID 114281304
4,5-dimethyl-2-N-octan-4-ylbenzene-1,2-diamine (PubChem CID 114281304) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 4,5-dimethyl-2-N-octan-4-ylbenzene-1,2-diamine.
| Compound Name | 4,5-dimethyl-2-N-octan-4-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 114281304 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 4,5-dimethyl-2-N-octan-4-ylbenzene-1,2-diamine |
| SMILES | CCCCC(CCC)Nc1cc(C)c(C)cc1N |
| InChI | InChI=1S/C16H28N2/c1-5-7-9-14(8-6-2)18-16-11-13(4)12(3)10-15(16)17/h10-11,14,18H,5-9,17H2,1-4H3 |
| InChIKey | JELXWLCAJRYDBH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|