C13H17NO4S — CID 114281362
2-(4,5-dimethyl-2-nitrophenyl)sulfanyl-3-methylbutanoic acid (PubChem CID 114281362) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-(4,5-dimethyl-2-nitrophenyl)sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-(4,5-dimethyl-2-nitrophenyl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 114281362 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-(4,5-dimethyl-2-nitrophenyl)sulfanyl-3-methylbutanoic acid |
| SMILES | Cc1cc(SC(C(=O)O)C(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H17NO4S/c1-7(2)12(13(15)16)19-11-6-9(4)8(3)5-10(11)14(17)18/h5-7,12H,1-4H3,(H,15,16) |
| InChIKey | PNRRYYLBMZKJJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|