C14H20INO — CID 114282912
N-[(3-iodophenyl)methyl]-3-methoxy-2,2-dimethylcyclobutan-1-amine (PubChem CID 114282912) has the molecular formula C14H20INO and a molecular weight of 345.22 g/mol. Its IUPAC name is N-[(3-iodophenyl)methyl]-3-methoxy-2,2-dimethylcyclobutan-1-amine.
| Compound Name | N-[(3-iodophenyl)methyl]-3-methoxy-2,2-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 114282912 |
| Molecular Formula | C14H20INO |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(3-iodophenyl)methyl]-3-methoxy-2,2-dimethylcyclobutan-1-amine |
| SMILES | COC1CC(NCc2cccc(I)c2)C1(C)C |
| InChI | InChI=1S/C14H20INO/c1-14(2)12(8-13(14)17-3)16-9-10-5-4-6-11(15)7-10/h4-7,12-13,16H,8-9H2,1-3H3 |
| InChIKey | MZSIRJYYIBQMTN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|