About 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid
6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid (PubChem CID 114119978) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid |
| PubChem CID | 114119978 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid |
| SMILES | COC1CC(NCc2cccc(C(=O)O)n2)C1(C)C |
| InChI | InChI=1S/C14H20N2O3/c1-14(2)11(7-12(14)19-3)15-8-9-5-4-6-10(16-9)13(17)18/h4-6,11-12,15H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | XABCNFHHTPGAFU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid?
The IUPAC name of 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid (CID 114119978) is 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid is COC1CC(NCc2cccc(C(=O)O)n2)C1(C)C.
What is the InChIKey of 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid?
The InChIKey is XABCNFHHTPGAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-14(2)11(7-12(14)19-3)15-8-9-5-4-6-10(16-9)13(17)18/h4-6,11-12,15H,7-8H2,1-3H3,(H,17,18).
What are the key properties of 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid?
6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid has a molecular weight of 264.32 g/mol, XLogP of 1.68, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(3-methoxy-2,2-dimethylcyclobutyl)amino]methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 114119978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).