C14H25N5 — CID 114283593
[(2,3-dimethylimidazol-4-yl)-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine (PubChem CID 114283593) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is [(2,3-dimethylimidazol-4-yl)-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine.
| Compound Name | [(2,3-dimethylimidazol-4-yl)-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 114283593 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | [(2,3-dimethylimidazol-4-yl)-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine |
| SMILES | Cc1ncc(C(NN)C2CC3CCC(C2)N3C)n1C |
| InChI | InChI=1S/C14H25N5/c1-9-16-8-13(18(9)2)14(17-15)10-6-11-4-5-12(7-10)19(11)3/h8,10-12,14,17H,4-7,15H2,1-3H3 |
| InChIKey | YIQHEEDAIFJFQZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|