C15H28N2O — CID 114284241
1-(4,4-dimethylpentyl)-4-ethoxypiperidine-4-carbonitrile (PubChem CID 114284241) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-4-ethoxypiperidine-4-carbonitrile.
| Compound Name | 1-(4,4-dimethylpentyl)-4-ethoxypiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 114284241 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-4-ethoxypiperidine-4-carbonitrile |
| SMILES | CCOC1(C#N)CCN(CCCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2O/c1-5-18-15(13-16)8-11-17(12-9-15)10-6-7-14(2,3)4/h5-12H2,1-4H3 |
| InChIKey | ATKNYLMNJZWFOP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |